#!/usr/bin/env python # coding: utf-8 # # "The Crank-Nicolson method implemented from scratch in Python" # > "In this article we implement the well-known finite difference method Crank-Nicolson in Python." # - toc: true # - branch: master # - badges: true # - comments: true # - categories: [python, numpy, numerical analysis, partial differential equations] # # The Crank-Nicolson Method # The [Crank-Nicolson method](http://en.wikipedia.org/wiki/Crank%E2%80%93Nicolson_method) is a well-known finite difference method for the # numerical integration of the heat equation and closely related partial differential equations. # # We often resort to a Crank-Nicolson (CN) scheme when we integrate numerically reaction-diffusion systems in one space dimension # # $$\frac{\partial u}{\partial t} = D \frac{\partial^2 u}{\partial x^2} + f(u),$$ # # $$\frac{\partial u}{\partial x}\Bigg|_{x = 0, L} = 0,$$ # # where $u$ is our concentration variable, $x$ is the space variable, $D$ is the diffusion coefficient of $u$, $f$ is the reaction term, # and $L$ is the length of our one-dimensional space domain. # # Note that we use [Neumann boundary conditions](http://en.wikipedia.org/wiki/Neumann_boundary_condition) and specify that the solution # $u$ has zero space slope at the boundaries, effectively prohibiting entrance or exit of material at the boundaries (no-flux boundary conditions). # ## Finite Difference Methods # Many fantastic textbooks and tutorials have been written about finite difference methods, for instance a free textbook by # [Lloyd Trefethen](http://people.maths.ox.ac.uk/trefethen/pdetext.html). # # Here we describe a few basic aspects of finite difference methods. # # The above reaction-diffusion equation describes the time evolution of variable $u(x,t)$ in one space dimension ($u$ is a line concentration). # If we knew an analytic expression for $u(x,t)$ then we could plot $u$ in a two-dimensional coordinate system with axes $t$ and $x$. # # To approximate $u(x,t)$ numerically we discretize this two-dimensional coordinate system resulting, in the simplest case, in a # two-dimensional [regular grid](http://en.wikipedia.org/wiki/Regular_grid). # This picture is employed commonly when constructing finite differences methods, see for instance # [Figure 3.2.1 of Trefethen](http://people.maths.ox.ac.uk/trefethen/3all.pdf). # # Let us discretize both time and space as follows: # # $$t_n = n \Delta t,~ n = 0, \ldots, N-1,$$ # # $$x_j = j \Delta x,~ j = 0, \ldots, J-1,$$ # # where $N$ and $J$ are the number of discrete time and space points in our grid respectively. # $\Delta t$ and $\Delta x$ are the time step and space step respectively and defined as follows: # # $$\Delta t = T / N,$$ # # $$\Delta x = L / J,$$ # # where $T$ is the point in time up to which we will integrate $u$ numerically. # # Our ultimate goal is to construct a numerical method that allows us to approximate the unknonwn analytic solution $u(x,t)$ # reasonably well in these discrete grid points. # # That is we want construct a method that computes values $U(j \Delta x, n \Delta t)$ (note: capital $U$) so that # # $$U(j \Delta x, n \Delta t) \approx u(j \Delta x, n \Delta t)$$ # # As a shorthand we will write $U_j^n = U(j \Delta x, n \Delta t)$ and $(j,n)$ to refer to grid point $(j \Delta x, n \Delta t)$. # ## The Crank-Nicolson Stencil # Based on the two-dimensional grid we construct we then approximate the operators of our reaction-diffusion system. # # For instance, to approximate the time derivative on the left-hand side in grid point $(j,n)$ we use the values of $U$ in two specific grid points: # # $$\frac{\partial u}{\partial t}\Bigg|_{x = j \Delta x, t = n \Delta t} \approx \frac{U_j^{n+1} - U_j^n}{\Delta t}.$$ # # We can think of this scheme as a stencil that we superimpose on our $(x,t)$-grid and this particular stencil is # commonly referred to as [forward difference](http://en.wikipedia.org/wiki/Finite_difference#Forward.2C_backward.2C_and_central_differences). # # The spatial part of the [Crank-Nicolson stencil](http://journals.cambridge.org/abstract_S0305004100023197) # (or see [Table 3.2.2 of Trefethen](http://people.maths.ox.ac.uk/trefethen/3all.pdf)) # for the heat equation ($u_t = u_{xx}$) approximates the # [Laplace operator](http://en.wikipedia.org/wiki/Laplace_operator) of our equation and takes the following form # # $$\frac{\partial^2 u}{\partial x^2}\Bigg|_{x = j \Delta x, t = n \Delta t} \approx \frac{1}{2 \Delta x^2} \left( U_{j+1}^n - 2 U_j^n + U_{j-1}^n + U_{j+1}^{n+1} - 2 U_j^{n+1} + U_{j-1}^{n+1}\right).$$ # # To approximate $f(u(j \Delta x, n \Delta t))$ we write simply $f(U_j^n)$. # # These approximations define the stencil for our numerical method as pictured on [Wikipedia](http://en.wikipedia.org/wiki/Crank%E2%80%93Nicolson_method). # # ![SVG](https://dl.dropboxusercontent.com/u/129945779/georgio/CN-stencil.svg) # # Applying this stencil to grid point $(j,n)$ gives us the following approximation of our reaction-diffusion equation: # # $$\frac{U_j^{n+1} - U_j^n}{\Delta t} = \frac{D}{2 \Delta x^2} \left( U_{j+1}^n - 2 U_j^n + U_{j-1}^n + U_{j+1}^{n+1} - 2 U_j^{n+1} + U_{j-1}^{n+1}\right) + f(U_j^n).$$ # ## Reordering Stencil into Linear System # Let us define $\sigma = \frac{D \Delta t}{2 \Delta x^2}$ and reorder the above approximation of our reaction-diffusion equation: # # $$-\sigma U_{j-1}^{n+1} + (1+2\sigma) U_j^{n+1} -\sigma U_{j+1}^{n+1} = \sigma U_{j-1}^n + (1-2\sigma) U_j^n + \sigma U_{j+1}^n + \Delta t f(U_j^n).$$ # # This equation makes sense for space indices $j = 1,\ldots,J-2$ but it does not make sense for indices $j=0$ and $j=J-1$ (on the boundaries): # # $$j=0:~-\sigma U_{-1}^{n+1} + (1+2\sigma) U_0^{n+1} -\sigma U_{1}^{n+1} = \sigma U_{-1}^n + (1-2\sigma) U_0^n + \sigma U_{1}^n + \Delta t f(U_0^n),$$ # # $$j=J-1:~-\sigma U_{J-2}^{n+1} + (1+2\sigma) U_{J-1}^{n+1} -\sigma U_{J}^{n+1} = \sigma U_{J-2}^n + (1-2\sigma) U_{J-1}^n + \sigma U_{J}^n + \Delta t f(U_{J-1}^n).$$ # # The problem here is that the values $U_{-1}^n$ and $U_J^n$ lie outside our grid. # # However, we can work out what these values should equal by considering our Neumann boundary condition. # Let us discretize our boundary condition at $j=0$ with the # [backward difference](http://en.wikipedia.org/wiki/Finite_difference#Forward.2C_backward.2C_and_central_differences) and # at $j=J-1$ with the # [forward difference](http://en.wikipedia.org/wiki/Finite_difference#Forward.2C_backward.2C_and_central_differences): # # $$\frac{U_1^n - U_0^n}{\Delta x} = 0,$$ # # $$\frac{U_J^n - U_{J-1}^n}{\Delta x} = 0.$$ # # These two equations make it clear that we need to amend our above numerical approximation for # $j=0$ with the identities $U_0^n = U_1^n$ and $U_0^{n+1} = U_1^{n+1}$, and # for $j=J-1$ with the identities $U_{J-1}^n = U_J^n$ and $U_{J-1}^{n+1} = U_J^{n+1}$. # # Let us reinterpret our numerical approximation of the line concentration of $u$ in a fixed point in time as a vector $\mathbf{U}^n$: # # $$\mathbf{U}^n = # \begin{bmatrix} U_0^n \\ \vdots \\ U_{J-1}^n \end{bmatrix}.$$ # # Using this notation we can now write our above approximation for a fixed point in time, $t = n \Delta t$, compactly as a linear system: # # $$ # \begin{bmatrix} # 1+\sigma & -\sigma & 0 & 0 & 0 & \cdots & 0 & 0 & 0 & 0\\ # -\sigma & 1+2\sigma & -\sigma & 0 & 0 & \cdots & 0 & 0 & 0 & 0 \\ # 0 & -\sigma & 1+2\sigma & -\sigma & \cdots & 0 & 0 & 0 & 0 & 0 \\ # 0 & 0 & \ddots & \ddots & \ddots & \ddots & 0 & 0 & 0 & 0 \\ # 0 & 0 & 0 & 0 & 0 & 0 & 0 & -\sigma & 1+2\sigma & -\sigma \\ # 0 & 0 & 0 & 0 & 0 & 0 & 0 & 0 & -\sigma & 1+\sigma # \end{bmatrix} # \begin{bmatrix} # U_0^{n+1} \\ # U_1^{n+1} \\ # U_2^{n+1} \\ # \vdots \\ # U_{J-2}^{n+1} \\ # U_{J-1}^{n+1} # \end{bmatrix} = # \begin{bmatrix} # 1-\sigma & \sigma & 0 & 0 & 0 & \cdots & 0 & 0 & 0 & 0\\ # \sigma & 1-2\sigma & \sigma & 0 & 0 & \cdots & 0 & 0 & 0 & 0 \\ # 0 & \sigma & 1-2\sigma & \sigma & \cdots & 0 & 0 & 0 & 0 & 0 \\ # 0 & 0 & \ddots & \ddots & \ddots & \ddots & 0 & 0 & 0 & 0 \\ # 0 & 0 & 0 & 0 & 0 & 0 & 0 & \sigma & 1-2\sigma & \sigma \\ # 0 & 0 & 0 & 0 & 0 & 0 & 0 & 0 & \sigma & 1-\sigma # \end{bmatrix} # \begin{bmatrix} # U_0^{n} \\ # U_1^{n} \\ # U_2^{n} \\ # \vdots \\ # U_{J-2}^{n} \\ # U_{J-1}^{n} # \end{bmatrix} + # \begin{bmatrix} # \Delta t f(U_0^n) \\ # \Delta t f(U_1^n) \\ # \Delta t f(U_2^n) \\ # \vdots \\ # \Delta t f(U_{J-2}^n) \\ # \Delta t f(U_{J-1}^n) # \end{bmatrix}. # $$ # # Note that since our numerical integration starts with a well-defined initial condition at $n=0$, $\mathbf{U}^0$, the # vector $\mathbf{U}^{n+1}$ on the left-hand side is the only unknown in this system of linear equations. # # Thus, to integrate numerically our reaction-diffusion system from time point $n$ to $n+1$ we need to solve numerically for vector $\mathbf{U}^{n+1}$. # # Let us call the matrix on the left-hand side $A$, the one on the right-hand side $B$, # and the vector on the right-hand side $\mathbf{f}^n$. # Using this notation we can write the above system as # # $$A \mathbf{U}^{n+1} = B \mathbf{U}^n + f^n.$$ # # In this linear equation, matrices $A$ and $B$ are defined by our problem: we need to specify these matrices once for our # problem and incorporate our boundary conditions in them. # Vector $\mathbf{f}^n$ is a function of $\mathbf{U}^n$ and so needs to be reevaluated in every time point $n$. # We also need to carry out one matrix-vector multiplication every time point, $B \mathbf{U}^n$, and # one vector-vector addition, $B \mathbf{U}^n + f^n$. # # The most expensive numerical operation is inversion of matrix $A$ to solve for $\mathbf{U}^{n+1}$, however we may # get away with doing this only once and store the inverse of $A$ as $A^{-1}$: # # $$\mathbf{U}^{n+1} = A^{-1} \left( B \mathbf{U}^n + f^n \right).$$ # ## A Crank-Nicolson Example in Python # Let us apply the CN method to a two-variable reaction-diffusion system that was introduced by # [Mori *et al.*](http://www.sciencedirect.com/science/article/pii/S0006349508704442): # # $$\frac{\partial u}{\partial t} = D_u \frac{\partial^2 u}{\partial x^2} + f(u,v),$$ # # $$\frac{\partial v}{\partial t} = D_v \frac{\partial^2 v}{\partial x^2} - f(u,v),$$ # # with Neumann boundary conditions # # $$\frac{\partial u}{\partial x}\Bigg|_{x=0,L} = 0,$$ # # $$\frac{\partial v}{\partial x}\Bigg|_{x=0,L} = 0.$$ # # The variables of this system, $u$ and $v$, represent the concetrations of the active form and its inactive form respectively. # The reaction term $f(u,v)$ describes the interchange (activation and inactivation) between these two states of the protein. # A particular property of this system is that the inactive has much greater diffusivity that the active form, $D_v \gg D_u$. # # Using the CN method to integrate this system numerically, we need to set up two separate approximations # # $$A_u \mathbf{U}^{n+1} = B_u \mathbf{U}^n + \mathbf{f}^n,$$ # # $$A_v \mathbf{V}^{n+1} = B_v \mathbf{V}^n - \mathbf{f}^n,$$ # # with two different $\sigma$ terms, $\sigma_u = \frac{D_u \Delta t}{2 \Delta x^2}$ and $\sigma_v = \frac{D_v \Delta t}{2 \Delta x^2}$. # ### Import Packages # For the matrix-vector multiplication, vector-vector addition, and matrix inversion that we will need to carry # out we will use the Python library [NumPy](http://www.numpy.org/). # To visualize our numerical solutions, we will use [pyplot](http://matplotlib.org/api/pyplot_api.html). # In[1]: import numpy from matplotlib import pyplot # Numpy allows us to truncate the numerical values of matrices and vectors to improve their display with # [`set_printoptions`](http://docs.scipy.org/doc/numpy/reference/generated/numpy.set_printoptions.html). # In[2]: numpy.set_printoptions(precision=3) # ### Specify Grid # Our one-dimensional domain has unit length and we define `J = 100` equally spaced # grid points in this domain. # This divides our domain into `J-1` subintervals, each of length `dx`. # In[153]: L = 1. J = 100 dx = float(L)/float(J-1) x_grid = numpy.array([j*dx for j in range(J)]) # Equally, we define `N = 1000` equally spaced grid points on our time domain of length `T = 200` thus dividing our time domain into `N-1` intervals of length `dt`. # In[154]: T = 200 N = 1000 dt = float(T)/float(N-1) t_grid = numpy.array([n*dt for n in range(N)]) # ### Specify System Parameters and the Reaction Term # We choose our parameter values based on the work by # [Mori *et al.*](http://www.sciencedirect.com/science/article/pii/S0006349508704442). # In[155]: D_v = float(10.)/float(100.) D_u = 0.01 * D_v k0 = 0.067 f = lambda u, v: dt*(v*(k0 + float(u*u)/float(1. + u*u)) - u) g = lambda u, v: -f(u,v) sigma_u = float(D_u*dt)/float((2.*dx*dx)) sigma_v = float(D_v*dt)/float((2.*dx*dx)) total_protein = 2.26 # ### Specify the Initial Condition # As discussed by # [Mori *et al.*](http://www.sciencedirect.com/science/article/pii/S0006349508704442), # we can expect to observe interesting behaviour in the steady state of this system # if we choose a heterogeneous initial condition for $u$. # # Here, we initialize $u$ with a step-like heterogeneity: # In[156]: no_high = 10 U = numpy.array([0.1 for i in range(no_high,J)] + [2. for i in range(0,no_high)]) V = numpy.array([float(total_protein-dx*sum(u))/float(J*dx) for i in range(0,J)]) # Note that we make certain that total protein amounts equal a certain value, # `total_protein`. # The importance of this was discussed by # [Walther *et al.*](http://link.springer.com/article/10.1007%2Fs11538-012-9766-5). # # Let us plot our initial condition for confirmation: # In[157]: ylim((0., 2.1)) xlabel('x'); ylabel('concentration') pyplot.plot(x_grid, U) pyplot.plot(x_grid, V) pyplot.show() # The blue curve is the initial condition for $U$, stored in Python variable `U`, # and the green curve is the initial condition for $V$ stored in `V`. # ### Create Matrices # The matrices that we need to construct are all tridiagonal so they are easy to # construct with # [`numpy.diagflat`](http://docs.scipy.org/doc/numpy/reference/generated/numpy.diagflat.html). # In[158]: A_u = numpy.diagflat([-sigma_u for i in range(J-1)], -1) +\ numpy.diagflat([1.+sigma_u]+[1.+2.*sigma_u for i in range(J-2)]+[1.+sigma_u]) +\ numpy.diagflat([-sigma_u for i in range(J-1)], 1) B_u = numpy.diagflat([sigma_u for i in range(J-1)], -1) +\ numpy.diagflat([1.-sigma_u]+[1.-2.*sigma_u for i in range(J-2)]+[1.-sigma_u]) +\ numpy.diagflat([sigma_u for i in range(J-1)], 1) A_v = numpy.diagflat([-sigma_v for i in range(J-1)], -1) +\ numpy.diagflat([1.+sigma_v]+[1.+2.*sigma_v for i in range(J-2)]+[1.+sigma_v]) +\ numpy.diagflat([-sigma_v for i in range(J-1)], 1) B_v = numpy.diagflat([sigma_v for i in range(J-1)], -1) +\ numpy.diagflat([1.-sigma_v]+[1.-2.*sigma_v for i in range(J-2)]+[1.-sigma_v]) +\ numpy.diagflat([sigma_v for i in range(J-1)], 1) # To confirm, this is what `A_u` looks like: # In[159]: print A_u # ### Solve the System Iteratively # To advance our system by one time step, we need to do one matrix-vector multiplication followed by one vector-vector addition on the right hand side. # # To facilitate this, we rewrite our reaction term so that it accepts concentration vectors $\mathbf{U}^n$ and $\mathbf{V}^n$ as arguments # and returns vector $\mathbf{f}^n$. # # As a reminder, this is our non-vectorial definition of $f$ # # f = lambda u, v: v*(k0 + float(u*u)/float(1. + u*u)) - u # In[160]: f_vec = lambda U, V: numpy.multiply(dt, numpy.subtract(numpy.multiply(V, numpy.add(k0, numpy.divide(numpy.multiply(U,U), numpy.add(1., numpy.multiply(U,U))))), U)) # Let us make certain that this produces the same values as our non-vectorial `f`: # In[161]: print f(U[0], V[0]) # In[162]: print f(U[-1], V[-1]) # In[163]: print f_vec(U, V) # Accounting for rounding of the displayed values due to the `set_printoptions` we set above, we # can see that `f` and `f_vec` generate the same values for our initial condition at both ends of our domain. # We will use [`numpy.linalg.solve`](http://docs.scipy.org/doc/numpy/reference/generated/numpy.linalg.solve.html) to solve # our linear system each time step. # While we integrate our system over time we will record both `U` and `V` at each # time step in `U_record` and `V_record` respectively so that we can plot # our numerical solutions over time. # In[164]: U_record = [] V_record = [] U_record.append(U) V_record.append(V) for ti in range(1,N): U_new = numpy.linalg.solve(A_u, B_u.dot(U) + f_vec(U,V)) V_new = numpy.linalg.solve(A_v, B_v.dot(V) - f_vec(U,V)) U = U_new V = V_new U_record.append(U) V_record.append(V) # ### Plot the Numerical Solution # Let us take a look at the numerical solution we attain after `N` time steps. # In[165]: ylim((0., 2.1)) xlabel('x'); ylabel('concentration') pyplot.plot(x_grid, U) pyplot.plot(x_grid, V) pyplot.show() # And here is a [kymograph](http://en.wikipedia.org/wiki/Kymograph) of the values of `U`. # This plot shows concisely the behaviour of `U` over time and we can clear observe the wave-pinning # behaviour described by [Mori *et al.*](http://www.sciencedirect.com/science/article/pii/S0006349508704442). # Furthermore, we observe that this wave pattern is stable for about 50 units of time and we therefore # conclude that this wave pattern is a stable steady state of our system. # In[169]: U_record = numpy.array(U_record) V_record = numpy.array(V_record) fig, ax = subplots() xlabel('x'); ylabel('t') heatmap = ax.pcolor(x_grid, t_grid, U_record, vmin=0., vmax=1.2)